EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22N4O9 |
| Net Charge | 0 |
| Average Mass | 390.349 |
| Monoisotopic Mass | 390.13868 |
| SMILES | C[C@H](N)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H22N4O9/c1-5(15)11(23)16-6(2)12(24)17-7(3-9(19)20)13(25)18-8(14(26)27)4-10(21)22/h5-8H,3-4,15H2,1-2H3,(H,16,23)(H,17,24)(H,18,25)(H,19,20)(H,21,22)(H,26,27)/t5-,6-,7-,8-/m0/s1 |
| InChIKey | YHOPXCAOTRUGLV-XAMCCFCMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Ala-Asp-Asp (CHEBI:73314) has functional parent L-alanine (CHEBI:16977) |
| Ala-Ala-Asp-Asp (CHEBI:73314) has functional parent L-aspartic acid (CHEBI:17053) |
| Ala-Ala-Asp-Asp (CHEBI:73314) has role metabolite (CHEBI:25212) |
| Ala-Ala-Asp-Asp (CHEBI:73314) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-alanyl-L-alanyl-L-α-aspartyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| AADD | ChEBI |
| A-A-D-D | ChEBI |
| L-Ala-L-Ala-L-Asp-L-Asp | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4890080 | Reaxys |