EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17N3O4 |
| Net Charge | 0 |
| Average Mass | 231.252 |
| Monoisotopic Mass | 231.12191 |
| SMILES | C[C@H](N)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C9H17N3O4/c1-4(10)7(13)11-5(2)8(14)12-6(3)9(15)16/h4-6H,10H2,1-3H3,(H,11,13)(H,12,14)(H,15,16)/t4-,5-,6-/m0/s1 |
| InChIKey | BYXHQQCXAJARLQ-ZLUOBGJFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Ala-Ala (CHEBI:73313) has functional parent L-alanine (CHEBI:16977) |
| Ala-Ala-Ala (CHEBI:73313) has role metabolite (CHEBI:25212) |
| Ala-Ala-Ala (CHEBI:73313) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-alanyl-L-alanyl-L-alanine |
| Synonyms | Source |
|---|---|
| A-A-A | ChEBI |
| AAA | ChEBI |
| L-Ala-L-Ala-L-Ala | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728079 | Reaxys |
| CAS:5874-90-8 | ChemIDplus |