EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H35N7O2 |
| Net Charge | 0 |
| Average Mass | 477.613 |
| Monoisotopic Mass | 477.28522 |
| SMILES | N#C/N=C(\NCCCOc1cccc(CN2CCCCC2)c1)NCCNC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C26H35N7O2/c27-20-32-26(31-14-13-29-25(34)22-8-10-23(28)11-9-22)30-12-5-17-35-24-7-4-6-21(18-24)19-33-15-2-1-3-16-33/h4,6-11,18H,1-3,5,12-17,19,28H2,(H,29,34)(H2,30,31,32) |
| InChIKey | CICDSYWWNDGAGD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | H2-receptor antagonist H2-receptor antagonists are the drugs that selectively bind to but do not activate histamine H2 receptors, thereby blocking the actions of endogenous histamine. |
| Application: | H2-receptor antagonist H2-receptor antagonists are the drugs that selectively bind to but do not activate histamine H2 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminopotentidine (CHEBI:73303) has role H2-receptor antagonist (CHEBI:37961) |
| aminopotentidine (CHEBI:73303) is a aromatic ether (CHEBI:35618) |
| aminopotentidine (CHEBI:73303) is a benzamides (CHEBI:22702) |
| aminopotentidine (CHEBI:73303) is a guanidines (CHEBI:24436) |
| aminopotentidine (CHEBI:73303) is a nitrile (CHEBI:18379) |
| aminopotentidine (CHEBI:73303) is a piperidines (CHEBI:26151) |
| aminopotentidine (CHEBI:73303) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 4-amino-N-[2-(N''-cyano-N'-{3-[3-(piperidin-1-ylmethyl)phenoxy]propyl}carbamimidamido)ethyl]benzamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5487725 | Reaxys |
| Citations |
|---|