EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31NO |
| Net Charge | 0 |
| Average Mass | 361.529 |
| Monoisotopic Mass | 361.24056 |
| SMILES | [H][C@]12CN3CC[C@](O)(C(C)(C)C)C[C@]3([H])c3cccc(c31)CCc1ccccc12 |
| InChI | InChI=1S/C25H31NO/c1-24(2,3)25(27)13-14-26-16-21-19-9-5-4-7-17(19)11-12-18-8-6-10-20(23(18)21)22(26)15-25/h4-10,21-22,27H,11-16H2,1-3H3/t21-,22-,25-/m1/s1 |
| InChIKey | ZZJYIKPMDIWRSN-TZBSWOFLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Application: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-butaclamol (CHEBI:73298) has role dopaminergic antagonist (CHEBI:48561) |
| (+)-butaclamol (CHEBI:73298) is a amino alcohol (CHEBI:22478) |
| (+)-butaclamol (CHEBI:73298) is a organic heteropentacyclic compound (CHEBI:38164) |
| (+)-butaclamol (CHEBI:73298) is a tertiary alcohol (CHEBI:26878) |
| (+)-butaclamol (CHEBI:73298) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (3R,4aR,13bR)-3-tert-butyl-2,3,4,4a,8,9,13b,14-octahydro-1H-benzo[6,7]cyclohepta[1,2,3-de]pyrido[2,1-a]isoquinolin-3-ol |
| Synonyms | Source |
|---|---|
| butaclamol | ChEBI |
| d-Butaclamol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Butaclamol | Wikipedia |
| US2012035203 | Patent |
| WO2010129273 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5767449 | Reaxys |
| CAS:56245-67-1 | ChemIDplus |
| Citations |
|---|