EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18ClNO |
| Net Charge | 0 |
| Average Mass | 287.790 |
| Monoisotopic Mass | 287.10769 |
| SMILES | CN1CCc2cc(Cl)c(O)cc2C(c2ccccc2)C1 |
| InChI | InChI=1S/C17H18ClNO/c1-19-8-7-13-9-16(18)17(20)10-14(13)15(11-19)12-5-3-2-4-6-12/h2-6,9-10,15,20H,7-8,11H2,1H3 |
| InChIKey | GOTMKOSCLKVOGG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Application: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SCH 23390 (CHEBI:73297) has role dopaminergic antagonist (CHEBI:48561) |
| SCH 23390 (CHEBI:73297) is a benzazepine (CHEBI:35676) |
| SCH 23390 (CHEBI:73297) is a organochlorine compound (CHEBI:36683) |
| SCH 23390 (CHEBI:73297) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 8-chloro-3-methyl-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-ol |
| Synonym | Source |
|---|---|
| 7-chloro-3-methyl-1-phenyl-1,2,4,5-tetrahydro-3-benzazepin-8-ol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| SCH_23390 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4323128 | Reaxys |
| Citations |
|---|