EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32N4O6 |
| Net Charge | 0 |
| Average Mass | 400.476 |
| Monoisotopic Mass | 400.23218 |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](C)N)C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C18H32N4O6/c1-9(2)8-12(20-15(24)10(3)19)16(25)21-14(11(4)23)17(26)22-7-5-6-13(22)18(27)28/h9-14,23H,5-8,19H2,1-4H3,(H,20,24)(H,21,25)(H,27,28)/t10-,11+,12-,13-,14-/m0/s1 |
| InChIKey | FCXAUASCMJOFEY-NDKCEZKHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Leu-Thr-Pro (CHEBI:73292) has functional parent L-alanine (CHEBI:16977) |
| Ala-Leu-Thr-Pro (CHEBI:73292) has functional parent L-leucine (CHEBI:15603) |
| Ala-Leu-Thr-Pro (CHEBI:73292) has functional parent L-proline (CHEBI:17203) |
| Ala-Leu-Thr-Pro (CHEBI:73292) has functional parent L-threonine (CHEBI:16857) |
| Ala-Leu-Thr-Pro (CHEBI:73292) has role metabolite (CHEBI:25212) |
| Ala-Leu-Thr-Pro (CHEBI:73292) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-alanyl-L-leucyl-L-threonyl-L-proline |
| Synonyms | Source |
|---|---|
| ALTP | ChEBI |
| L-Ala-L-Leu-L-Thr-L-Pro | ChEBI |