EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21ClN2O |
| Net Charge | 0 |
| Average Mass | 352.865 |
| Monoisotopic Mass | 352.13424 |
| SMILES | CCC(C)N(C)C(=O)c1cc2ccccc2c(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C21H21ClN2O/c1-4-14(2)24(3)21(25)19-13-15-9-5-6-10-16(15)20(23-19)17-11-7-8-12-18(17)22/h5-14H,4H2,1-3H3 |
| InChIKey | RAVIZVQZGXBOQO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PK-11195 (CHEBI:73290) has role antineoplastic agent (CHEBI:35610) |
| PK-11195 (CHEBI:73290) is a aromatic amide (CHEBI:62733) |
| PK-11195 (CHEBI:73290) is a isoquinolines (CHEBI:24922) |
| PK-11195 (CHEBI:73290) is a monocarboxylic acid amide (CHEBI:29347) |
| PK-11195 (CHEBI:73290) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| N-sec-butyl-1-(2-chlorophenyl)-N-methylisoquinoline-3-carboxamide |
| Synonyms | Source |
|---|---|
| 1-(2-Chlorophenyl)-N-methyl-N-(1-methylpropyl)-3-isoquinolinecarboxamide | ChemIDplus |
| PK11195 | ChemIDplus |
| RP 52028 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4264456 | Reaxys |
| CAS:85532-75-8 | ChemIDplus |
| Citations |
|---|