EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:73288 - CGP 12177
| Formula | C14H21N3O3 |
| Net Charge | 0 |
| Average Mass | 279.340 |
| Monoisotopic Mass | 279.15829 |
| SMILES | CC(C)(C)NCC(O)COc1cccc2nc(=O)nc12 |
| InChI | InChI=1S/C14H21N3O3/c1-14(2,3)15-7-9(18)8-20-11-6-4-5-10-12(11)17-13(19)16-10/h4-6,9,15,18H,7-8H2,1-3H3,(H2,16,17,19) |
| InChIKey | UMQUQWCJKFOUGV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| Application: | beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CGP 12177 (CHEBI:73288) has role β-adrenergic antagonist (CHEBI:35530) |
| CGP 12177 (CHEBI:73288) is a aromatic ether (CHEBI:35618) |
| CGP 12177 (CHEBI:73288) is a benzimidazoles (CHEBI:22715) |
| CGP 12177 (CHEBI:73288) is a secondary alcohol (CHEBI:35681) |
| CGP 12177 (CHEBI:73288) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 4-[3-(tert-butylamino)-2-hydroxypropoxy]-1,3-dihydro-2H-benzimidazol-2-one |
| Synonyms | Source |
|---|---|
| 4-(3-tert-Butylamino-2-hydroxypropoxy)benzimidazol-2-one | ChemIDplus |
| Cgp-12177 | ChemIDplus |
| Cgp 12177A | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:753194 | Reaxys |
| CAS:81047-99-6 | ChemIDplus |
| Citations |
|---|