EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N2O3 |
| Net Charge | 0 |
| Average Mass | 234.255 |
| Monoisotopic Mass | 234.10044 |
| SMILES | COC1(C2=NCCN2)COc2ccccc2O1 |
| InChI | InChI=1S/C12H14N2O3/c1-15-12(11-13-6-7-14-11)8-16-9-4-2-3-5-10(9)17-12/h2-5H,6-8H2,1H3,(H,13,14) |
| InChIKey | HQGWKNGAKBPTBX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| Application: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methoxyidazoxan (CHEBI:73287) has functional parent idazoxan (CHEBI:5862) |
| 2-methoxyidazoxan (CHEBI:73287) has role α-adrenergic antagonist (CHEBI:37890) |
| 2-methoxyidazoxan (CHEBI:73287) is a benzodioxine (CHEBI:64096) |
| 2-methoxyidazoxan (CHEBI:73287) is a cyclic ketal (CHEBI:59779) |
| 2-methoxyidazoxan (CHEBI:73287) is a imidazolines (CHEBI:53095) |
| IUPAC Name |
|---|
| 2-(2-methoxy-2,3-dihydro-1,4-benzodioxin-2-yl)-4,5-dihydro-1H-imidazole |
| Synonyms | Source |
|---|---|
| 2-[2-(2-methoxy-1,4-benzodioxanyl)]imidazoline | ChEBI |
| RX 821002 | ChemIDplus |
| RX-821002 | ChemIDplus |
| α-methoxyidazoxan | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-1714 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4296114 | Reaxys |
| CAS:102575-24-6 | ChemIDplus |
| Citations |
|---|