EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16N6O4 |
| Net Charge | 0 |
| Average Mass | 308.298 |
| Monoisotopic Mass | 308.12330 |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H16N6O4/c1-2-14-11(21)8-6(19)7(20)12(22-8)18-4-17-5-9(13)15-3-16-10(5)18/h3-4,6-8,12,19-20H,2H2,1H3,(H,14,21)(H2,13,15,16)/t6-,7+,8-,12+/m0/s1 |
| InChIKey | JADDQZYHOWSFJD-FLNNQWSLSA-N |
| Roles Classification |
|---|
| Biological Roles: | adenosine A2A receptor agonist An agonist at the A2A receptor. EC 3.1.4.* (phosphoric diester hydrolase) inhibitor An EC 3.1.* (ester hydrolase) inhibitor that interferes with the action of a phosphoric diester hydrolase (EC 3.1.4.*). adenosine A1 receptor agonist An agonist at the A1 receptor. |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-ethyl-5'-carboxamidoadenosine (CHEBI:73284) has functional parent adenosine (CHEBI:16335) |
| N-ethyl-5'-carboxamidoadenosine (CHEBI:73284) has role adenosine A1 receptor agonist (CHEBI:65057) |
| N-ethyl-5'-carboxamidoadenosine (CHEBI:73284) has role adenosine A2A receptor agonist (CHEBI:73310) |
| N-ethyl-5'-carboxamidoadenosine (CHEBI:73284) has role antineoplastic agent (CHEBI:35610) |
| N-ethyl-5'-carboxamidoadenosine (CHEBI:73284) has role EC 3.1.4.* (phosphoric diester hydrolase) inhibitor (CHEBI:50218) |
| N-ethyl-5'-carboxamidoadenosine (CHEBI:73284) has role vasodilator agent (CHEBI:35620) |
| N-ethyl-5'-carboxamidoadenosine (CHEBI:73284) is a adenosines (CHEBI:22260) |
| N-ethyl-5'-carboxamidoadenosine (CHEBI:73284) is a monocarboxylic acid amide (CHEBI:29347) |
| Synonyms | Source |
|---|---|
| 1-(6-Amino-9H-purin-9-yl)-1-deoxy-N-ethyl-beta-D-ribofuranuronamide | ChemIDplus |
| 5'-N-Ethylcarboxamidoadenosine | ChemIDplus |
| Adenosine-5'-(N-ethylcarboxamide) | ChemIDplus |
| NECA | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DB03719 | DrugBank |
| NEC | PDBeChem |
| US2007281902 | Patent |
| WO2009006089 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:630061 | Reaxys |
| CAS:35920-39-9 | ChemIDplus |
| Citations |
|---|