EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H29N7O6 |
| Net Charge | 0 |
| Average Mass | 499.528 |
| Monoisotopic Mass | 499.21793 |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(NCCc4ccc(CCC(=O)O)cc4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H29N7O6/c1-2-25-21(35)18-16(33)17(34)22(36-18)30-11-27-15-19(24)28-23(29-20(15)30)26-10-9-13-5-3-12(4-6-13)7-8-14(31)32/h3-6,11,16-18,22,33-34H,2,7-10H2,1H3,(H,25,35)(H,31,32)(H3,24,26,28,29)/t16-,17+,18-,22+/m0/s1 |
| InChIKey | PAOANWZGLPPROA-RQXXJAGISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | adenosine A2A receptor agonist An agonist at the A2A receptor. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CGS-21680 (CHEBI:73283) has functional parent adenosine (CHEBI:16335) |
| CGS-21680 (CHEBI:73283) has role adenosine A2A receptor agonist (CHEBI:73310) |
| CGS-21680 (CHEBI:73283) has role anti-inflammatory agent (CHEBI:67079) |
| CGS-21680 (CHEBI:73283) is a adenosines (CHEBI:22260) |
| CGS-21680 (CHEBI:73283) is a dicarboxylic acid monoamide (CHEBI:35735) |
| CGS-21680 (CHEBI:73283) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-{4-[2-({6-amino-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxytetrahydrofuran-2-yl]-9H-purin-2-yl}amino)ethyl]phenyl}propanoic acid |
| Synonyms | Source |
|---|---|
| 2-(4-(2-Carboxyethyl)phenethylamino)-5'-N-ethylcarboxamidoadenosine | ChemIDplus |
| CGS 21680 | ChemIDplus |
| 4-(2-((6-Amino-9-(N-ethyl-beta-D-ribofuranuronamidosyl)-9H-purin-2-yl)amino)ethyl)benzenepropanoic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CGS-21680 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3641320 | Reaxys |
| CAS:120225-54-9 | ChemIDplus |
| Citations |
|---|