EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15N2O4.Na |
| Net Charge | 0 |
| Average Mass | 346.318 |
| Monoisotopic Mass | 346.09295 |
| SMILES | COc1c(C)c(C(=O)c2ccc(N)c(C(=O)[O-])c2)n2ccccc12.[Na+] |
| InChI | InChI=1S/C18H16N2O4.Na/c1-10-15(20-8-4-3-5-14(20)17(10)24-2)16(21)11-6-7-13(19)12(9-11)18(22)23;/h3-9H,19H2,1-2H3,(H,22,23);/q;+1/p-1 |
| InChIKey | JFBMSTWZURKQOC-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | fibroblast growth factor receptor antagonist An antagonist at the fibroblast growth factor receptor. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium 2-amino-5-[(1-methoxy-2-methylindolizin-3-yl)carbonyl]benzoate (CHEBI:73280) has part 2-amino-5-[(1-methoxy-2-methylindolizin-3-yl)carbonyl]benzoate (CHEBI:73308) |
| sodium 2-amino-5-[(1-methoxy-2-methylindolizin-3-yl)carbonyl]benzoate (CHEBI:73280) has role antineoplastic agent (CHEBI:35610) |
| sodium 2-amino-5-[(1-methoxy-2-methylindolizin-3-yl)carbonyl]benzoate (CHEBI:73280) has role fibroblast growth factor receptor antagonist (CHEBI:63457) |
| sodium 2-amino-5-[(1-methoxy-2-methylindolizin-3-yl)carbonyl]benzoate (CHEBI:73280) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 2-amino-5-[(1-methoxy-2-methylindolizin-3-yl)carbonyl]benzoate |
| Synonyms | Source |
|---|---|
| SSR128129E | ChEBI |
| SSR | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11430504 | Reaxys |
| Citations |
|---|