EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H23ClO2 |
| Net Charge | 0 |
| Average Mass | 378.899 |
| Monoisotopic Mass | 378.13866 |
| SMILES | OCCOc1ccc(/C(=C(/CCCl)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23ClO2/c25-16-15-23(19-7-3-1-4-8-19)24(20-9-5-2-6-10-20)21-11-13-22(14-12-21)27-18-17-26/h1-14,26H,15-18H2/b24-23- |
| InChIKey | LUMKNAVTFCDUIE-VHXPQNKSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. estrogen receptor modulator A substance that possess antiestrogenic actions but can also produce estrogenic effects as well. It acts as complete or partial agonist or as antagonist. It can be either steroidal or nonsteroidal in structure. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ospemifene (CHEBI:73275) has parent hydride stilbene (CHEBI:26775) |
| ospemifene (CHEBI:73275) has role anti-inflammatory agent (CHEBI:67079) |
| ospemifene (CHEBI:73275) has role antineoplastic agent (CHEBI:35610) |
| ospemifene (CHEBI:73275) has role estrogen receptor modulator (CHEBI:50739) |
| ospemifene (CHEBI:73275) is a aromatic ether (CHEBI:35618) |
| ospemifene (CHEBI:73275) is a organochlorine compound (CHEBI:36683) |
| ospemifene (CHEBI:73275) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| 2-{4-[(1Z)-4-chloro-1,2-diphenylbut-1-en-1-yl]phenoxy}ethanol |
| Synonyms | Source |
|---|---|
| ospemifene | KEGG DRUG |
| Fc-1271 | ChemIDplus |
| FC-1271a | ChemIDplus |
| Deamino-hydroxytoremifene | ChemIDplus |
| 2-(p-((Z)-4-Chloro-1,2-diphenyl-1-butenyl)phenoxy)ethanol | ChemIDplus |
| 2-(4-(4-Chloro-1,2-diphenyl-but-1-enyl)phenoxy)ethanol | ChemIDplus |
| Brand Name | Source |
|---|---|
| Osphena | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D08958 | KEGG DRUG |
| US2008207956 | Patent |
| US2005182143 | Patent |
| US2005187301 | Patent |
| US2005187302 | Patent |
| WO2005105052 | Patent |
| WO2010107475 | Patent |
| Ospemifene | Wikipedia |
| US2011015448 | Patent |
| EP2275098 | Patent |
| EP2286806 | Patent |
| CN101636372 | Patent |
| 4749 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10283864 | Reaxys |
| CAS:128607-22-7 | KEGG DRUG |
| CAS:128607-22-7 | ChemIDplus |
| Citations |
|---|