EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H28N4O5 |
| Net Charge | 0 |
| Average Mass | 356.423 |
| Monoisotopic Mass | 356.20597 |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@@H](CCC(N)=O)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C16H28N4O5/c1-9(2)8-10(17)14(22)19-11(5-6-13(18)21)15(23)20-7-3-4-12(20)16(24)25/h9-12H,3-8,17H2,1-2H3,(H2,18,21)(H,19,22)(H,24,25)/t10-,11-,12-/m0/s1 |
| InChIKey | CQGSYZCULZMEDE-SRVKXCTJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Gln-Pro (CHEBI:73270) has role metabolite (CHEBI:25212) |
| Leu-Gln-Pro (CHEBI:73270) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-leucyl-L-glutaminyl-L-proline |
| Synonyms | Source |
|---|---|
| LQP | ChEBI |
| L-Leu-L-Gln-L-Pro | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4825392 | Reaxys |