EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2O |
| Net Charge | 0 |
| Average Mass | 190.246 |
| Monoisotopic Mass | 190.11061 |
| SMILES | CNCCc1cnc2ccc(O)cc12 |
| InChI | InChI=1S/C11H14N2O/c1-12-5-4-8-7-13-11-3-2-9(14)6-10(8)11/h2-3,6-7,12-14H,4-5H2,1H3 |
| InChIKey | ASUSBMNYRHGZIG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methylserotonin (CHEBI:48294) has functional parent serotonin (CHEBI:28790) |
| N-methylserotonin (CHEBI:48294) has role human metabolite (CHEBI:77746) |
| N-methylserotonin (CHEBI:48294) has role plant metabolite (CHEBI:76924) |
| N-methylserotonin (CHEBI:48294) is a phenols (CHEBI:33853) |
| N-methylserotonin (CHEBI:48294) is a tryptamines (CHEBI:27162) |
| Incoming Relation(s) |
| N-methylserotonin(1+) (CHEBI:746957) is conjugate acid of N-methylserotonin (CHEBI:48294) |
| IUPAC Name |
|---|
| 3-[2-(methylamino)ethyl]-1H-indol-5-ol |
| Synonym | Source |
|---|---|
| N-Methylserotonin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C06212 | KEGG COMPOUND |
| HMDB0004369 | HMDB |
| N-Methylserotonin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:145589 | Reaxys |
| CAS:1134-01-6 | ChemIDplus |
| Citations |
|---|