EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO2 |
| Net Charge | 0 |
| Average Mass | 151.165 |
| Monoisotopic Mass | 151.06333 |
| SMILES | COC(=O)c1ccccc1N |
| InChI | InChI=1S/C8H9NO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,9H2,1H3 |
| InChIKey | VAMXMNNIEUEQDV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl anthranilate (CHEBI:73244) has functional parent anthranilic acid (CHEBI:30754) |
| methyl anthranilate (CHEBI:73244) has role flavouring agent (CHEBI:35617) |
| methyl anthranilate (CHEBI:73244) has role metabolite (CHEBI:25212) |
| methyl anthranilate (CHEBI:73244) is a benzoate ester (CHEBI:36054) |
| Synonyms | Source |
|---|---|
| 2-Aminobenzoic acid methyl ester | ChemIDplus |
| 2-Carbomethoxyaniline | ChemIDplus |
| 2-(Methoxycarbonyl)aniline | NIST Chemistry WebBook |
| 2-(Methoxycarbonyl)aniline | ChemIDplus |
| Anthranilic acid methyl ester | ChemIDplus |
| Methyl o-aminobenzoate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| O-methyl anthranilate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1626 | BPDB |
| HMDB0029703 | HMDB |
| Methyl_anthranilate | Wikipedia |
| US2011104099 | Patent |
| Citations |
|---|