EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O4 |
| Net Charge | 0 |
| Average Mass | 264.321 |
| Monoisotopic Mass | 264.13616 |
| SMILES | [H][C@@]12C(=C)C(=O)O[C@@]1([H])CC(=C)[C@H](O)CC/C(C)=C/[C@H]2O |
| InChI | InChI=1S/C15H20O4/c1-8-4-5-11(16)9(2)7-13-14(12(17)6-8)10(3)15(18)19-13/h6,11-14,16-17H,2-5,7H2,1H3/b8-6+/t11-,12-,13+,14+/m1/s1 |
| InChIKey | KNEQPJSDSYNUHP-RFPYWGSLSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tatridin B (CHEBI:73239) has role metabolite (CHEBI:25212) |
| tatridin B (CHEBI:73239) is a diol (CHEBI:23824) |
| tatridin B (CHEBI:73239) is a germacrane sesquiterpenoid (CHEBI:68588) |
| tatridin B (CHEBI:73239) is a organic heterobicyclic compound (CHEBI:27171) |
| tatridin B (CHEBI:73239) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aS,4R,5E,9R,11aS)-4,9-dihydroxy-6-methyl-3,10-bis(methylene)-3a,4,7,8,9,10,11,11a-octahydrocyclodeca[b]furan-2(3H)-one |
| Synonyms | Source |
|---|---|
| tatridin-B | ChEBI |
| 1β-hydroxy-1-desoxotamirin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4235530 | Reaxys |
| CAS:41653-76-3 | ChemIDplus |