EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O5 |
| Net Charge | 0 |
| Average Mass | 362.466 |
| Monoisotopic Mass | 362.20932 |
| SMILES | CC(C)=CCC(=O)[C@@]1(O)C(O)=C(C(=O)CC(C)C)C(=O)[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C21H30O5/c1-12(2)7-9-15-19(24)18(16(22)11-14(5)6)20(25)21(15,26)17(23)10-8-13(3)4/h7-8,14-15,25-26H,9-11H2,1-6H3/t15-,21+/m0/s1 |
| InChIKey | QARXXMMQVDCYGZ-YCRPNKLZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Humulus lupulus (ncbitaxon:3486) | cone (BTO:0000280) | PubMed (17624889) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-cis-isohumulone (CHEBI:73236) has role plant metabolite (CHEBI:76924) |
| (+)-cis-isohumulone (CHEBI:73236) is a cyclic ketone (CHEBI:3992) |
| (+)-cis-isohumulone (CHEBI:73236) is a enol (CHEBI:33823) |
| (+)-cis-isohumulone (CHEBI:73236) is a enone (CHEBI:51689) |
| (+)-cis-isohumulone (CHEBI:73236) is a tertiary alcohol (CHEBI:26878) |
| (+)-cis-isohumulone (CHEBI:73236) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (4S,5R)-3,4-dihydroxy-2-(3-methylbutanoyl)-5-(3-methylbut-2-en-1-yl)-4-(4-methylpent-3-enoyl)cyclopent-2-en-1-one |
| Synonym | Source |
|---|---|
| cis-isohumulone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2062912 | Reaxys |
| CAS:25522-96-7 | SUBMITTER |
| Citations |
|---|