EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O7 |
| Net Charge | 0 |
| Average Mass | 284.264 |
| Monoisotopic Mass | 284.08960 |
| SMILES | [H]C(=O)c1ccccc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H16O7/c14-5-7-3-1-2-4-8(7)19-13-12(18)11(17)10(16)9(6-15)20-13/h1-5,9-13,15-18H,6H2/t9-,10-,11+,12-,13-/m1/s1 |
| InChIKey | BGOFCVIGEYGEOF-UJPOAAIJSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| helicin (CHEBI:73235) has functional parent salicin (CHEBI:17814) |
| helicin (CHEBI:73235) has functional parent salicylaldehyde (CHEBI:16008) |
| helicin (CHEBI:73235) has role metabolite (CHEBI:25212) |
| helicin (CHEBI:73235) is a benzaldehydes (CHEBI:22698) |
| helicin (CHEBI:73235) is a monosaccharide derivative (CHEBI:63367) |
| helicin (CHEBI:73235) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-formylphenyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 2-hydroxybenzaldehyde β-D-glucopyranoside | ChEBI |
| 2-(β-D-glucopyranosyloxy)benzaldehyde | ChemIDplus |
| salicylaldehyde β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:89595 | Reaxys |
| CAS:618-65-5 | ChemIDplus |
| Citations |
|---|