EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O5 |
| Net Charge | 0 |
| Average Mass | 280.320 |
| Monoisotopic Mass | 280.13107 |
| SMILES | [H][C@@]12C/C=C3\C[C@@](C)(CC[C@H]3OO)[C@H](O)[C@@]1([H])OC(=O)C2=C |
| InChI | InChI=1S/C15H20O5/c1-8-10-4-3-9-7-15(2,6-5-11(9)20-18)13(16)12(10)19-14(8)17/h3,10-13,16,18H,1,4-7H2,2H3/b9-3+/t10-,11+,12-,13+,15+/m0/s1 |
| InChIKey | JXXWNBNYEWOORY-KHTYUQOESA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| crispolide (CHEBI:73231) has role metabolite (CHEBI:25212) |
| crispolide (CHEBI:73231) is a organic heterotricyclic compound (CHEBI:26979) |
| crispolide (CHEBI:73231) is a peroxol (CHEBI:35924) |
| crispolide (CHEBI:73231) is a secondary alcohol (CHEBI:35681) |
| crispolide (CHEBI:73231) is a sesquiterpene lactone (CHEBI:37667) |
| crispolide (CHEBI:73231) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aS,5E,7R,10R,11S,11aS)-7-hydroperoxy-11-hydroxy-10-methyl-3-methylene-3a,4,7,8,9,10,11,11a-octahydro-6,10-methanocyclodeca[b]furan-2(3H)-one |
| Synonym | Source |
|---|---|
| (3aS,7R,10R,11S,11aS)-3a,4,7,8,9,10,11,11a-Octahydro-7-hydroperoxy-11-hydroxy-10-methyl-3-methylene-6,10-methanocyclodeca[b]furan-2(3H)-one | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| HMDB0036695 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7097446 | Reaxys |
| CAS:83217-86-1 | HMDB |