EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO |
| Net Charge | 0 |
| Average Mass | 151.209 |
| Monoisotopic Mass | 151.09971 |
| SMILES | CNCC(O)c1ccccc1 |
| InChI | InChI=1S/C9H13NO/c1-10-7-9(11)8-5-3-2-4-6-8/h2-6,9-11H,7H2,1H3 |
| InChIKey | ZCTYHONEGJTYQV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (6775642) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methylphenylethanolamine (CHEBI:16913) has role human metabolite (CHEBI:77746) |
| N-methylphenylethanolamine (CHEBI:16913) has role plant metabolite (CHEBI:76924) |
| N-methylphenylethanolamine (CHEBI:16913) is a alkaloid (CHEBI:22315) |
| N-methylphenylethanolamine (CHEBI:16913) is a phenylethanolamines (CHEBI:25990) |
| N-methylphenylethanolamine (CHEBI:16913) is conjugate base of N-methylphenylethanolaminium (CHEBI:57946) |
| Incoming Relation(s) |
| N-methylphenylethanolaminium (CHEBI:57946) is conjugate acid of N-methylphenylethanolamine (CHEBI:16913) |
| IUPAC Name |
|---|
| 2-(methylamino)-1-phenylethanol |
| Synonyms | Source |
|---|---|
| N-Methylphenylethanolamine | KEGG COMPOUND |
| (+-)-Halostachine | ChemIDplus |
| (+-)-alpha-((Methylamino)methyl)benzenemethanol | ChemIDplus |
| Benzyl alcohol, alpha-((methylamino)methyl)-, dl- | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C03711 | KEGG COMPOUND |
| N-METHYLPHENYLETHANOLAMINE | MetaCyc |
| HMDB0001387 | HMDB |
| Halostachine | Wikipedia |
| LSM-36938 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1072841 | Reaxys |
| CAS:68579-60-2 | KEGG COMPOUND |
| CAS:68579-60-2 | ChemIDplus |
| Citations |
|---|