EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14NO |
| Net Charge | +1 |
| Average Mass | 152.217 |
| Monoisotopic Mass | 152.10699 |
| SMILES | C[NH2+]CC(O)c1ccccc1 |
| InChI | InChI=1S/C9H13NO/c1-10-7-9(11)8-5-3-2-4-6-8/h2-6,9-11H,7H2,1H3/p+1 |
| InChIKey | ZCTYHONEGJTYQV-UHFFFAOYSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (6775642) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methylphenylethanolaminium (CHEBI:57946) has role human metabolite (CHEBI:77746) |
| N-methylphenylethanolaminium (CHEBI:57946) has role plant metabolite (CHEBI:76924) |
| N-methylphenylethanolaminium (CHEBI:57946) is a ammonium ion derivative (CHEBI:35274) |
| N-methylphenylethanolaminium (CHEBI:57946) is conjugate acid of N-methylphenylethanolamine (CHEBI:16913) |
| Incoming Relation(s) |
| N-methylphenylethanolamine (CHEBI:16913) is conjugate base of N-methylphenylethanolaminium (CHEBI:57946) |
| IUPAC Name |
|---|
| 2-hydroxy-N-methyl-2-phenylethanaminium |
| Synonyms | Source |
|---|---|
| (2-hydroxy-2-phenylethyl)(methyl)azanium | ChEBI |
| N-methylphenylethanolaminium(1+) | ChEBI |
| N-methylphenylethanolaminium cation | ChEBI |
| UniProt Name | Source |
|---|---|
| N-methylphenylethanolamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| N-METHYLPHENYLETHANOLAMINE | MetaCyc |