EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24Br4N10O5 |
| Net Charge | 0 |
| Average Mass | 828.115 |
| Monoisotopic Mass | 823.86646 |
| SMILES | [H][C@]12[C@H](CNC(=O)c3cc(Br)c(Br)n3)[C@@H](CNC(=O)c3cc(Br)c(Br)n3)[C@H](O)[C@@]13NC(=N)N[C@@]3([H])O[C@@]1([H])NC(=N)N[C@@]21O |
| InChI | InChI=1S/C22H24Br4N10O5/c23-7-1-9(31-13(7)25)15(38)29-3-5-6(4-30-16(39)10-2-8(24)14(26)32-10)12(37)21-11(5)22(40)18(34-20(28)36-22)41-17(21)33-19(27)35-21/h1-2,5-6,11-12,17-18,31-32,37,40H,3-4H2,(H,29,38)(H,30,39)(H3,27,33,35)(H3,28,34,36)/t5-,6-,11+,12+,17+,18-,21+,22-/m1/s1 |
| InChIKey | MJHZRZBAUGHJOJ-RVJSRHHYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stylissa massa (ncbitaxon:279589) | - | PubMed (12816422) |
| Roles Classification |
|---|
| Biological Roles: | EC 2.5.1.59 (protein geranylgeranyltransferase type I) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of protein geranylgeranyltransferase type I (EC 2.5.1.59). animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| massadine (CHEBI:73199) has role animal metabolite (CHEBI:75767) |
| massadine (CHEBI:73199) has role EC 2.5.1.59 (protein geranylgeranyltransferase type I) inhibitor (CHEBI:67267) |
| massadine (CHEBI:73199) has role marine metabolite (CHEBI:76507) |
| massadine (CHEBI:73199) is a alkaloid (CHEBI:22315) |
| massadine (CHEBI:73199) is a guanidines (CHEBI:24436) |
| massadine (CHEBI:73199) is a organobromine compound (CHEBI:37141) |
| massadine (CHEBI:73199) is a pyrrolecarboxamide (CHEBI:48611) |
| massadine (CHEBI:73199) is conjugate base of massadine(2+) (CHEBI:66684) |
| Incoming Relation(s) |
| massadine(2+) (CHEBI:66684) is conjugate acid of massadine (CHEBI:73199) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9539519 | Reaxys |
| Citations |
|---|