EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24Br4N10O5 |
| Net Charge | 0 |
| Average Mass | 828.115 |
| Monoisotopic Mass | 823.86646 |
| SMILES | [H][C@]12[C@H](CNC(=O)c3cc(Br)c(Br)n3)[C@@H](CNC(=O)c3cc(Br)c(Br)n3)[C@H](O)[C@@]13NC(=N)N[C@@]3([H])O[C@@]1([H])NC(=N)N[C@@]21O |
| InChI | InChI=1S/C22H24Br4N10O5/c23-7-1-9(31-13(7)25)15(38)29-3-5-6(4-30-16(39)10-2-8(24)14(26)32-10)12(37)21-11(5)22(40)18(34-20(28)36-22)41-17(21)33-19(27)35-21/h1-2,5-6,11-12,17-18,31-32,37,40H,3-4H2,(H,29,38)(H,30,39)(H3,27,33,35)(H3,28,34,36)/t5-,6-,11+,12+,17+,18-,21+,22-/m1/s1 |
| InChIKey | MJHZRZBAUGHJOJ-RVJSRHHYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stylissa massa (ncbitaxon:279589) | - | PubMed (12816422) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. EC 2.5.1.59 (protein geranylgeranyltransferase type I) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of protein geranylgeranyltransferase type I (EC 2.5.1.59). animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| massadine (CHEBI:73199) has role animal metabolite (CHEBI:75767) |
| massadine (CHEBI:73199) has role EC 2.5.1.59 (protein geranylgeranyltransferase type I) inhibitor (CHEBI:67267) |
| massadine (CHEBI:73199) has role marine metabolite (CHEBI:76507) |
| massadine (CHEBI:73199) is a alkaloid (CHEBI:22315) |
| massadine (CHEBI:73199) is a guanidines (CHEBI:24436) |
| massadine (CHEBI:73199) is a organobromine compound (CHEBI:37141) |
| massadine (CHEBI:73199) is a pyrrolecarboxamide (CHEBI:48611) |
| massadine (CHEBI:73199) is conjugate base of massadine(2+) (CHEBI:66684) |
| Incoming Relation(s) |
| massadine(2+) (CHEBI:66684) is conjugate acid of massadine (CHEBI:73199) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9539519 | Reaxys |
| Citations |
|---|