EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H3Cl2NO2 |
| Net Charge | 0 |
| Average Mass | 192.001 |
| Monoisotopic Mass | 190.95408 |
| SMILES | O=C(O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C6H3Cl2NO2/c7-4-1-3(6(10)11)2-5(8)9-4/h1-2H,(H,10,11) |
| InChIKey | SQSYNRCXIZHKAI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 1.11.1.11 (L-ascorbate peroxidase) inhibitor An EC 1.11.1.* (peroxidases) inhibitor that inhibits the action of L-ascorbate peroxidase (EC 1.11.1.11). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dichloroisonicotinic acid (CHEBI:73179) has role EC 1.11.1.11 (L-ascorbate peroxidase) inhibitor (CHEBI:73181) |
| 2,6-dichloroisonicotinic acid (CHEBI:73179) is a monocarboxylic acid (CHEBI:25384) |
| 2,6-dichloroisonicotinic acid (CHEBI:73179) is a organochlorine compound (CHEBI:36683) |
| 2,6-dichloroisonicotinic acid (CHEBI:73179) is a pyridines (CHEBI:26421) |
| IUPAC Names |
|---|
| 2,6-dichloroisonicotinic acid |
| 2,6-dichloropyridine-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| 2,6-dichloro-4-pyridinecarboxylic acid | ChEBI |
| INA | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:383737 | Reaxys |
| CAS:5398-44-7 | ChemIDplus |
| Citations |
|---|