EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6N2OS2 |
| Net Charge | 0 |
| Average Mass | 210.283 |
| Monoisotopic Mass | 209.99215 |
| SMILES | CSC(=O)c1cccc2nnsc12 |
| InChI | InChI=1S/C8H6N2OS2/c1-12-8(11)5-3-2-4-6-7(5)13-10-9-6/h2-4H,1H3 |
| InChIKey | UELITFHSCLAHKR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | profungicide A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active fungicide for which it is a profungicide. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Applications: | profungicide A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active fungicide for which it is a profungicide. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. plant activator Any compound that protects plants by activating their defence mechanisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acibenzolar-S-methyl (CHEBI:73178) has functional parent acibenzolar (CHEBI:73185) |
| acibenzolar-S-methyl (CHEBI:73178) has role antifungal agrochemical (CHEBI:86328) |
| acibenzolar-S-methyl (CHEBI:73178) has role plant activator (CHEBI:73182) |
| acibenzolar-S-methyl (CHEBI:73178) has role profungicide (CHEBI:136645) |
| acibenzolar-S-methyl (CHEBI:73178) is a benzothiadiazole (CHEBI:48864) |
| acibenzolar-S-methyl (CHEBI:73178) is a thioester (CHEBI:51277) |
| IUPAC Name |
|---|
| S-methyl 1,2,3-benzothiadiazole-7-carbothioate |
| Synonyms | Source |
|---|---|
| BTH | ChEBI |
| benzo-(1,2,3)-thiadiazole-7-carbothioic acid S-methyl ester | ChEBI |
| S-methyl benzo[1,2,3]thiadiazole-7-carbothioate | ChEBI |
| 7-(methylthiocarbonyl)-benzo-1,2,3-thiadiazole | ChEBI |
| 1,2,3-benzothiadiazole-7-carboxlic acid thiomethyl ester | ChEBI |
| Brand Name | Source |
|---|---|
| Actigard | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Acibenzolar-S-methyl | Wikipedia |
| acibenzolar-s-methyl | Alan Wood's Pesticides |
| 13 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8055445 | Reaxys |
| CAS:135158-54-2 | ChemIDplus |
| Citations |
|---|