EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18ClN3O |
| Net Charge | 0 |
| Average Mass | 327.815 |
| Monoisotopic Mass | 327.11384 |
| SMILES | CC(O)(c1ccccc1)C(Cc1ccc(Cl)cc1)n1cncn1 |
| InChI | InChI=1S/C18H18ClN3O/c1-18(23,15-5-3-2-4-6-15)17(22-13-20-12-21-22)11-14-7-9-16(19)10-8-14/h2-10,12-13,17,23H,11H2,1H3 |
| InChIKey | YULDTPKHZNKFEY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | brassinosteroid biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of brassinosteroids. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brassinazole (CHEBI:73177) has role brassinosteroid biosynthesis inhibitor (CHEBI:73189) |
| brassinazole (CHEBI:73177) is a monochlorobenzenes (CHEBI:83403) |
| brassinazole (CHEBI:73177) is a tertiary alcohol (CHEBI:26878) |
| brassinazole (CHEBI:73177) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| 4-(4-chlorophenyl)-2-phenyl-3-(1H-1,2,4-triazol-1-yl)butan-2-ol |
| Synonym | Source |
|---|---|
| Brz | ChEBI |
| Citations |
|---|