EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H7ClF3NO5 |
| Net Charge | 0 |
| Average Mass | 361.659 |
| Monoisotopic Mass | 360.99648 |
| SMILES | O=C(O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H7ClF3NO5/c15-10-5-7(14(16,17)18)1-4-12(10)24-8-2-3-11(19(22)23)9(6-8)13(20)21/h1-6H,(H,20,21) |
| InChIKey | NUFNQYOELLVIPL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor An EC 1.3.3.* (oxidoreductase acting on donor CH-CH group with oxygen as acceptor) inhibitor that interferes with the action of protoporphyrinogen oxidase (EC 1.3.3.4). |
| Applications: | herbicide A substance used to destroy plant pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acifluorfen (CHEBI:73172) has role agrochemical (CHEBI:33286) |
| acifluorfen (CHEBI:73172) has role EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor (CHEBI:73192) |
| acifluorfen (CHEBI:73172) has role herbicide (CHEBI:24527) |
| acifluorfen (CHEBI:73172) is a C-nitro compound (CHEBI:35716) |
| acifluorfen (CHEBI:73172) is a aromatic ether (CHEBI:35618) |
| acifluorfen (CHEBI:73172) is a benzoic acids (CHEBI:22723) |
| acifluorfen (CHEBI:73172) is a monocarboxylic acid (CHEBI:25384) |
| acifluorfen (CHEBI:73172) is a organochlorine compound (CHEBI:36683) |
| acifluorfen (CHEBI:73172) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid |
| Synonyms | Source |
|---|---|
| 2-nitro-5-(2-chloro-4-(trifluoromethyl)phenoxy)benzoic acid | ChemIDplus |
| 5-(2-Chloro-α,α,α-trifluoro-p-tolyloxy)-2-nitrobenzoic acid | ChemIDplus |
| acifluorfene | ChemIDplus |
| Brand Name | Source |
|---|---|
| Blazer | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 819 | PPDB |
| Acifluorfen | Wikipedia |
| ACIFLUORFEN | MetaCyc |
| ACJ | PDBeChem |
| C22041 | KEGG COMPOUND |
| EP0706993 | Patent |
| HMDB0037112 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2953865 | Reaxys |
| CAS:50594-66-6 | ChemIDplus |
| CAS:50594-66-6 | NIST Chemistry WebBook |
| Citations |
|---|