EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10N2O2 |
| Net Charge | 0 |
| Average Mass | 118.136 |
| Monoisotopic Mass | 118.07423 |
| SMILES | CNC[C@H](N)C(=O)O |
| InChI | InChI=1S/C4H10N2O2/c1-6-2-3(5)4(7)8/h3,6H,2,5H2,1H3,(H,7,8)/t3-/m0/s1 |
| InChIKey | UJVHVMNGOZXSOZ-VKHMYHEASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | neurotoxin A poison that interferes with the functions of the nervous system. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-BMAA (CHEBI:73169) has role bacterial metabolite (CHEBI:76969) |
| L-BMAA (CHEBI:73169) has role neurotoxin (CHEBI:50910) |
| L-BMAA (CHEBI:73169) is a L-alanine derivative (CHEBI:83943) |
| L-BMAA (CHEBI:73169) is a diamino acid (CHEBI:35987) |
| L-BMAA (CHEBI:73169) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-BMAA (CHEBI:73169) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 3-(methylamino)-L-alanine |
| Synonyms | Source |
|---|---|
| 3-methylamino-L-alanine | KEGG COMPOUND |
| BMAA | ChemIDplus |
| L-α-amino-β-(methylamino)propanoic acid | ChEBI |
| L-α-amino-β-(methylamino)propionic acid | ChemIDplus |
| β-N-methylamino-L-alanine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4781252 | Reaxys |
| CAS:15920-93-1 | KEGG COMPOUND |
| CAS:15920-93-1 | ChemIDplus |
| Citations |
|---|