EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H75NO14 |
| Net Charge | 0 |
| Average Mass | 866.099 |
| Monoisotopic Mass | 865.51876 |
| SMILES | [H][C@]1([C@@H](C)[C@@H](O)[C@H](C)[C@@]2(O)C[C@@H](O[C@H]3C[C@@H](O)[C@H](OC(N)=O)[C@@H](C)O3)[C@H](C)[C@@H](/C=C/C)O2)OC(=O)/C(OC)=C/C(C)=C/[C@@H](C)[C@@H](O)[C@@H](CC)[C@@H](O)[C@H](C)C/C(C)=C/C=C/[C@@H]1OC |
| InChI | InChI=1S/C46H75NO14/c1-13-16-34-28(7)37(58-38-22-33(48)43(31(10)57-38)60-45(47)53)23-46(54,61-34)30(9)41(51)29(8)42-35(55-11)18-15-17-24(3)19-26(5)39(49)32(14-2)40(50)27(6)20-25(4)21-36(56-12)44(52)59-42/h13,15-18,20-21,26-35,37-43,48-51,54H,14,19,22-23H2,1-12H3,(H2,47,53)/b16-13+,18-15+,24-17+,25-20+,36-21-/t26-,27-,28-,29+,30+,31-,32+,33-,34-,35+,37-,38+,39+,40-,41-,42-,43-,46-/m1/s1 |
| InChIKey | DJZCTUVALDDONK-HQMSUKCRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.6.3.14 (H(+)-transporting two-sector ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of H+-transporting two-sector ATPase inhibitor (EC 3.6.3.14). antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| concanamycin A (CHEBI:73167) has role antifungal agent (CHEBI:35718) |
| concanamycin A (CHEBI:73167) has role EC 3.6.3.14 (H+-transporting two-sector ATPase) inhibitor (CHEBI:73214) |
| concanamycin A (CHEBI:73167) has role metabolite (CHEBI:25212) |
| concanamycin A (CHEBI:73167) is a carbamate ester (CHEBI:23003) |
| concanamycin A (CHEBI:73167) is a concanamycin (CHEBI:73195) |
| IUPAC Name |
|---|
| (5R)-3-O-(4-O-carbamoyl-2,6-dideoxy-β-D-arabino-hexopyranosyl)-2,4-dideoxy-1-C-{(2S,3R,4S)-4-[(2R,3S,4E,6E,9R,10S,11S,12R,13R,14E,16Z)-11-ethyl-10,12-dihydroxy-3,17-dimethoxy-7,9,13,15-tetramethyl-18-oxooxacyclooctadeca-4,6,14,16-tetraen-2-yl]-3-hydroxypentan-2-yl}-4-methyl-5-[(1E)-prop-1-en-1-yl]-α-D-threo-pentopyranose |
| Synonym | Source |
|---|---|
| folimycin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C15761 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:80890-47-7 | ChemIDplus |
| CAS:80890-47-7 | KEGG COMPOUND |
| Citations |
|---|