EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14ClN3O2 |
| Net Charge | 0 |
| Average Mass | 279.727 |
| Monoisotopic Mass | 279.07745 |
| SMILES | CC(C)n1nc(CC(=O)O)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H14ClN3O2/c1-8(2)17-13(9-3-5-10(14)6-4-9)15-11(16-17)7-12(18)19/h3-6,8H,7H2,1-2H3,(H,18,19) |
| InChIKey | AINWLLILXDVSIT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DAS734 (CHEBI:73166) has role herbicide (CHEBI:24527) |
| DAS734 (CHEBI:73166) has role plant growth retardant (CHEBI:35219) |
| DAS734 (CHEBI:73166) is a monocarboxylic acid (CHEBI:25384) |
| DAS734 (CHEBI:73166) is a organochlorine compound (CHEBI:36683) |
| DAS734 (CHEBI:73166) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| [5-(4-chlorophenyl)-1-isopropyl-1H-1,2,4-triazol-3-yl]acetic acid |
| Synonym | Source |
|---|---|
| DAS-734 | ChEBI |
| Citations |
|---|