EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N4O6S |
| Net Charge | 0 |
| Average Mass | 346.365 |
| Monoisotopic Mass | 346.09471 |
| SMILES | CCCN(CCC)c1c([N+](=O)[O-])cc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H18N4O6S/c1-3-5-14(6-4-2)12-10(15(17)18)7-9(23(13,21)22)8-11(12)16(19)20/h7-8H,3-6H2,1-2H3,(H2,13,21,22) |
| InChIKey | UNAHYJYOSSSJHH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antimitotic Any compound that inhibits cell division (mitosis). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oryzalin (CHEBI:73163) has role agrochemical (CHEBI:33286) |
| oryzalin (CHEBI:73163) has role antimitotic (CHEBI:64911) |
| oryzalin (CHEBI:73163) has role herbicide (CHEBI:24527) |
| oryzalin (CHEBI:73163) is a C-nitro compound (CHEBI:35716) |
| oryzalin (CHEBI:73163) is a aromatic amine (CHEBI:33860) |
| oryzalin (CHEBI:73163) is a sulfonamide (CHEBI:35358) |
| oryzalin (CHEBI:73163) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 4-(dipropylamino)-3,5-dinitrobenzenesulfonamide |
| Synonyms | Source |
|---|---|
| 3,5-Dinitro-N4,N4-dipropylsulphanilamide | ChemIDplus |
| 3,5-dinitro-N4,N4-dipropylsulfanilamide | Alan Wood's Pesticides |
| 4-(dipropylamino)-3,5-dinitrobenzene-1-sulfonamide | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 19044-88-3 | Alan Wood's Pesticides |
| 494 | PPDB |
| C18877 | KEGG COMPOUND |
| Oryzalin | Wikipedia |
| US2012108430 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2177305 | Reaxys |
| CAS:19044-88-3 | ChemIDplus |
| CAS:19044-88-3 | KEGG COMPOUND |
| CAS:19044-88-3 | NIST Chemistry WebBook |
| Citations |
|---|