EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13BrN2O2S |
| Net Charge | 0 |
| Average Mass | 377.263 |
| Monoisotopic Mass | 375.98811 |
| SMILES | O=S(=O)(NCc1ccccn1)c1ccc(Br)c2ccccc12 |
| InChI | InChI=1S/C16H13BrN2O2S/c17-15-8-9-16(14-7-2-1-6-13(14)15)22(20,21)19-11-12-5-3-4-10-18-12/h1-10,19H,11H2 |
| InChIKey | GJSDYQXOSHKOGX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. abscisic acid receptor agonist An agonist that binds to and activates abscisic acid receptors. plant growth regulator A chemical, natural or artificial, that can affect the rate of growth of a plant. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrabactin (CHEBI:73159) has role abscisic acid receptor agonist (CHEBI:73191) |
| pyrabactin (CHEBI:73159) has role hormone (CHEBI:24621) |
| pyrabactin (CHEBI:73159) has role plant growth regulator (CHEBI:26155) |
| pyrabactin (CHEBI:73159) is a naphthalenes (CHEBI:25477) |
| pyrabactin (CHEBI:73159) is a organobromine compound (CHEBI:37141) |
| pyrabactin (CHEBI:73159) is a pyridines (CHEBI:26421) |
| pyrabactin (CHEBI:73159) is a sulfonamide (CHEBI:35358) |
| Manual Xrefs | Databases |
|---|---|
| US2011230350 | Patent |
| US2010216643 | Patent |
| Pyrabactin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20607875 | Reaxys |
| CAS:419538-69-5 | Wikipedia |
| Citations |
|---|