EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H22N2O2 |
| Net Charge | 0 |
| Average Mass | 394.474 |
| Monoisotopic Mass | 394.16813 |
| SMILES | [H]C(=Nc1ccccc1C(=O)NC(C)c1ccccc1)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C26H22N2O2/c1-18(19-9-3-2-4-10-19)28-26(30)22-13-7-8-14-24(22)27-17-23-21-12-6-5-11-20(21)15-16-25(23)29/h2-18,29H,1H3,(H,28,30) |
| InChIKey | UXJFDYIHRJGPFS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). Sir2 inhibitor An EC 3.5.1.98 (histone deacetylase) inhibitor that interferes with the action of Sir2. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sirtinol (CHEBI:73158) has functional parent anthranilic acid (CHEBI:30754) |
| sirtinol (CHEBI:73158) has role anti-inflammatory agent (CHEBI:67079) |
| sirtinol (CHEBI:73158) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| sirtinol (CHEBI:73158) has role Sir2 inhibitor (CHEBI:71181) |
| sirtinol (CHEBI:73158) is a aldimine (CHEBI:33271) |
| sirtinol (CHEBI:73158) is a benzamides (CHEBI:22702) |
| sirtinol (CHEBI:73158) is a naphthols (CHEBI:25392) |
| IUPAC Name |
|---|
| 2-{[(2-hydroxy-1-naphthyl)methylene]amino}-N-(1-phenylethyl)benzamide |
| Manual Xrefs | Databases |
|---|---|
| US2008200489 | Patent |
| US2009137681 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15029840 | Reaxys |
| Citations |
|---|