EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H24N2O4 |
| Net Charge | 0 |
| Average Mass | 284.356 |
| Monoisotopic Mass | 284.17361 |
| SMILES | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
| InChI | InChI=1S/C14H24N2O4/c1-4-10(5-2)20-12-7-9(14(18)19)6-11(15)13(12)16-8(3)17/h7,10-13H,4-6,15H2,1-3H3,(H,16,17)(H,18,19)/t11-,12+,13+/m0/s1 |
| InChIKey | NENPYTRHICXVCS-YNEHKIRRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. |
| Applications: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oseltamivir acid (CHEBI:73139) has role antiviral drug (CHEBI:36044) |
| oseltamivir acid (CHEBI:73139) has role EC 3.2.1.18 (exo-α-sialidase) inhibitor (CHEBI:52425) |
| oseltamivir acid (CHEBI:73139) has role marine xenobiotic metabolite (CHEBI:83399) |
| oseltamivir acid (CHEBI:73139) is a acetate ester (CHEBI:47622) |
| oseltamivir acid (CHEBI:73139) is a amino acid (CHEBI:33709) |
| oseltamivir acid (CHEBI:73139) is a cyclohexenecarboxylic acid (CHEBI:23483) |
| oseltamivir acid (CHEBI:73139) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| (3R,4R,5S)-4-acetamido-5-amino-3-(pentan-3-yloxy)cyclohex-1-ene-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| GS 4071 | ChemIDplus |
| oseltamivir carboxylate | ChemIDplus |
| Ro 64-0802 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7714446 | Reaxys |
| CAS:187227-45-8 | ChemIDplus |
| Citations |
|---|