EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C55H68MgN4O6 |
| Net Charge | 0 |
| Average Mass | 905.476 |
| Monoisotopic Mass | 904.49893 |
| SMILES | C=CC1=C(C=O)C2=[N+]3C1=Cc1c(C)c4c5[n]1[Mg-2]31[n]3c(c(C)c(C=C)c3=C2)=CC2=[N+]1C(=C5[C@@H](C(=O)OC)C4=O)[C@@H](CCC(=O)OC/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@@H]2C |
| InChI | InChI=1S/C55H69N4O6.Mg/c1-12-38-35(8)42-27-43-36(9)40(23-24-48(61)65-26-25-34(7)22-16-21-33(6)20-15-19-32(5)18-14-17-31(3)4)52(58-43)50-51(55(63)64-11)54(62)49-37(10)44(59-53(49)50)28-46-39(13-2)41(30-60)47(57-46)29-45(38)56-42;/h12-13,25,27-33,36,40,51H,1-2,14-24,26H2,3-11H3,(H-,56,57,58,59,60,62);/q-1;+2/p-1/b34-25+;/t32-,33-,36+,40+,51-;/m1./s1 |
| InChIKey | NGKPZYGLFKXZKI-VBYMZDBQSA-M |
| Roles Classification |
|---|
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| divinyl chlorophyll b (CHEBI:73115) has role cofactor (CHEBI:23357) |
| divinyl chlorophyll b (CHEBI:73115) is a chlorophyll (CHEBI:28966) |
| divinyl chlorophyll b (CHEBI:73115) is a methyl ester (CHEBI:25248) |
| divinyl chlorophyll b (CHEBI:73115) is conjugate acid of divinyl chlorophyll b(1−) (CHEBI:73096) |
| Incoming Relation(s) |
| divinyl chlorophyll b(1−) (CHEBI:73096) is conjugate base of divinyl chlorophyll b (CHEBI:73115) |
| IUPAC Name |
|---|
| [methyl (3S,4S,21R)-13-formyl-4,8,18-trimethyl-20-oxo-3-(3-oxo-3-{[(2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-yl]oxy}propyl)-9,14-divinylphorbine-21-carboxylatato(2−)-κ4N23,N24,N25,N26]magnesium |
| Citations |
|---|