EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O3 |
| Net Charge | 0 |
| Average Mass | 456.711 |
| Monoisotopic Mass | 456.36035 |
| SMILES | [H][C@]12CC[C@]3(C)C(=CC[C@@]4(C(=O)O)CCC(C)(C)C[C@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H48O3/c1-25(2)16-17-30(24(32)33)15-10-21-28(6)12-8-19-26(3,4)23(31)11-14-27(19,5)20(28)9-13-29(21,7)22(30)18-25/h10,19-20,22-23,31H,8-9,11-18H2,1-7H3,(H,32,33)/t19-,20+,22-,23-,27-,28+,29+,30+/m0/s1 |
| InChIKey | BHHPRAFMEFGOLZ-QVUWEPBXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Maprounea africana (ncbitaxon:316848) | - | PubMed (6631436) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maprounic acid (CHEBI:73107) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| maprounic acid (CHEBI:73107) has role plant metabolite (CHEBI:76924) |
| maprounic acid (CHEBI:73107) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| maprounic acid (CHEBI:73107) is a pentacyclic triterpenoid (CHEBI:25872) |
| Incoming Relation(s) |
| 1β-hydroxymaprounic acid 3-p-hydroxybenzoate (CHEBI:66671) has functional parent maprounic acid (CHEBI:73107) |
| 2α-hydroxymaprounic acid 2,3-bis-p-hydroxybenzoate (CHEBI:66672) has functional parent maprounic acid (CHEBI:73107) |
| IUPAC Name |
|---|
| (4aS,6bR,8aR,10S,12aR,12bR,14aS,14bS)-10-hydroxy-2,2,6b,9,9,12a,14a-heptamethyl-1,3,4,5,6b,7,8,8a,9,10,11,12,12a,12b,13,14,14a,14b-octadecahydropicene-4a(2H)-carboxylic acid |
| Synonym | Source |
|---|---|
| aleuritolic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2823779 | Reaxys |
| CAS:26549-17-7 | ChemIDplus |
| Citations |
|---|