EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H34O6 |
| Net Charge | 0 |
| Average Mass | 490.596 |
| Monoisotopic Mass | 490.23554 |
| SMILES | CC(C)=CCC[C@@]1(C)C=Cc2c(O)c(CC=C(C)C)c(O)c(C(=O)/C=C/c3ccc(O)c(O)c3)c2O1 |
| InChI | InChI=1S/C30H34O6/c1-18(2)7-6-15-30(5)16-14-22-27(34)21(11-8-19(3)4)28(35)26(29(22)36-30)24(32)13-10-20-9-12-23(31)25(33)17-20/h7-10,12-14,16-17,31,33-35H,6,11,15H2,1-5H3/b13-10+/t30-/m0/s1 |
| InChIKey | SEHURCMYIALHJN-NEUDONKMSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-mallotophilippen E (CHEBI:73098) is a mallotophilippen E (CHEBI:73097) |
| (S)-mallotophilippen E (CHEBI:73098) is enantiomer of (R)-mallotophilippen E (CHEBI:73099) |
| Incoming Relation(s) |
| (RS)-mallotophilippen E (CHEBI:66659) has part (S)-mallotophilippen E (CHEBI:73098) |
| (R)-mallotophilippen E (CHEBI:73099) is enantiomer of (S)-mallotophilippen E (CHEBI:73098) |
| IUPAC Name |
|---|
| (2E)-1-[(2S)-5,7-dihydroxy-2-methyl-6-(3-methylbut-2-en-1-yl)-2-(4-methylpent-3-en-1-yl)-2H-chromen-8-yl]-3-(3,4-dihydroxyphenyl)prop-2-en-1-one |