EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C55H69MgN4O5 |
| Net Charge | -1 |
| Average Mass | 890.485 |
| Monoisotopic Mass | 889.51239 |
| SMILES | C=CC1=C(C)C2=Cc3c(C=C)c(C)c4[n]3[Mg-2]35[n]6c(c(C)c7c6=C(C6=[N+]3C(=C4)[C@@H](C)[C@@H]6CCC(=O)OC/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C-](C(=O)OC)C7=O)=CC1=[N+]25 |
| InChI | InChI=1S/C55H70N4O5.Mg/c1-13-39-35(8)42-28-44-37(10)41(24-25-48(60)64-27-26-34(7)23-17-22-33(6)21-16-20-32(5)19-15-18-31(3)4)52(58-44)50-51(55(62)63-12)54(61)49-38(11)45(59-53(49)50)30-47-40(14-2)36(9)43(57-47)29-46(39)56-42;/h13-14,26,28-33,37,41H,1-2,15-25,27H2,3-12H3,(H-,56,57,58,59,61);/q-2;+2/p-1/b34-26+;/t32-,33-,37+,41+;/m1./s1 |
| InChIKey | ZNGSRZUYGXSJBD-ONWAGYJKSA-M |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| divinyl chlorophyll a(1−) (CHEBI:73095) has role cofactor (CHEBI:23357) |
| divinyl chlorophyll a(1−) (CHEBI:73095) is a cyclic tetrapyrrole anion (CHEBI:58941) |
| divinyl chlorophyll a(1−) (CHEBI:73095) is conjugate base of divinyl chlorophyll a (CHEBI:73113) |
| Incoming Relation(s) |
| divinyl chlorophyll a (CHEBI:73113) is conjugate acid of divinyl chlorophyll a(1−) (CHEBI:73095) |
| IUPAC Name |
|---|
| [methyl (3S,4S)-4,8,13,18-tetramethyl-20-oxo-3-(3-oxo-3-{[(2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-yl]oxy}propyl)-9,14-divinylphorbine-21-carboxylatato(3−)-κ4N23,N24,N25,N26]magnesate(1−) |
| UniProt Name | Source |
|---|---|
| divinyl chlorophyll a | UniProt |
| Citations |
|---|