EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H19NO3 |
| Net Charge | 0 |
| Average Mass | 225.288 |
| Monoisotopic Mass | 225.13649 |
| SMILES | CC(C)(C)NCC(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H19NO3/c1-12(2,3)13-7-11(16)8-4-5-9(14)10(15)6-8/h4-6,11,13-16H,7H2,1-3H3 |
| InChIKey | PHSMOUBHYUFTDM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| Applications: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. anti-asthmatic drug A drug used to treat asthma. beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| colterol (CHEBI:73085) has role anti-asthmatic drug (CHEBI:49167) |
| colterol (CHEBI:73085) has role bronchodilator agent (CHEBI:35523) |
| colterol (CHEBI:73085) has role β-adrenergic agonist (CHEBI:35522) |
| colterol (CHEBI:73085) is a catechols (CHEBI:33566) |
| colterol (CHEBI:73085) is a ethanolamines (CHEBI:23981) |
| colterol (CHEBI:73085) is a secondary alcohol (CHEBI:35681) |
| colterol (CHEBI:73085) is a secondary amino compound (CHEBI:50995) |
| colterol (CHEBI:73085) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| 4-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,2-diol |
| INNs | Source |
|---|---|
| colterol | ChemIDplus |
| colterol | WHO MedNet |
| coltérol | WHO MedNet |
| colterolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (±)-N-tert-butylarterenol | ChemIDplus |
| (±)-N-t-butylnoradrenaline | ChemIDplus |
| (+/-)-N-tert-butylarterenol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2106130 | Reaxys |
| CAS:18866-78-9 | ChemIDplus |
| Citations |
|---|