EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H35N3O12 |
| Net Charge | 0 |
| Average Mass | 485.487 |
| Monoisotopic Mass | 485.22207 |
| SMILES | NC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](N)C[C@@H]2N)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H35N3O12/c19-2-6-8(23)10(25)12(27)17(30-6)32-15-4(20)1-5(21)16(14(15)29)33-18-13(28)11(26)9(24)7(3-22)31-18/h4-18,22-29H,1-3,19-21H2/t4-,5+,6+,7+,8+,9+,10-,11-,12+,13+,14-,15+,16-,17+,18+/m0/s1 |
| InChIKey | NZCOZAMBHLSNDW-HNDNCJINSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kanamycin D (CHEBI:73079) has functional parent kanamycin A (CHEBI:17630) |
| kanamycin D (CHEBI:73079) is a kanamycins (CHEBI:24951) |
| kanamycin D (CHEBI:73079) is conjugate base of kanamycin D(3+) (CHEBI:72947) |
| Incoming Relation(s) |
| kanamycin (CHEBI:6104) has part kanamycin D (CHEBI:73079) |
| kanamycin D(3+) (CHEBI:72947) is conjugate acid of kanamycin D (CHEBI:73079) |
| IUPAC Name |
|---|
| (1S,2S,3R,4S,6R)-4,6-diamino-3-[(6-amino-6-deoxy-α-D-glucopyranosyl)oxy]-2-hydroxycyclohexyl α-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 3''-deamino-3''-hydroxykanamycin A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-14138 | MetaCyc |
| Citations |
|---|