EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H47NO5 |
| Net Charge | 0 |
| Average Mass | 441.653 |
| Monoisotopic Mass | 441.34542 |
| SMILES | CCCCCCCC/C=C\CCCCCC(O)CC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C25H47NO5/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(27)19-25(30)31-23(20-24(28)29)21-26(2,3)4/h12-13,22-23,27H,5-11,14-21H2,1-4H3/b13-12- |
| InChIKey | YBCVTTMMURGSEY-SEYXRHQNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| HeLa cell (BTO:0000567) | MetaboLights (MTBLS78) | ||
| Hepa-RG cell (BTO:0005736) | MetaboLights (MTBLS78) | ||
| NIH-3T3 cell (BTO:0000944) | MetaboLights (MTBLS78) | ||
| HeLa cell;NIH-3T3 cell (BTO:0000944) | MetaboLights (MTBLS78) | ||
| Mus musculus (ncbitaxon:10090) | Hepa-RG cell (BTO:0005736) | MetaboLights (MTBLS78) | Strain: C57BL/6J [EFO:0000606] |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9Z)-3-hydroxyoctadecenoylcarnitine (CHEBI:73076) has functional parent carnitine (CHEBI:17126) |
| (9Z)-3-hydroxyoctadecenoylcarnitine (CHEBI:73076) has role metabolite (CHEBI:25212) |
| (9Z)-3-hydroxyoctadecenoylcarnitine (CHEBI:73076) is a O-acylcarnitine (CHEBI:17387) |
| IUPAC Name |
|---|
| 3-{[(9Z)-3-hydroxyoctadec-9-enoyl]oxy}-4-(trimethylazaniumyl)butanoate |
| Synonyms | Source |
|---|---|
| 3-{[(9Z)-3-hydroxyoctadec-9-enoyl]oxy}-4-(trimethylammonio)butanoate | IUPAC |
| 3-hydroxy-9Z-octadecenoylcarnitine | ChEBI |
| 3-hydroxyoleoylcarnitine | ChEBI |
| 9-cis-3-hydroxyoctadecenoylcarnitine | ChEBI |
| Citations |
|---|