EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO |
| Net Charge | 0 |
| Average Mass | 99.133 |
| Monoisotopic Mass | 99.06841 |
| SMILES | CN1CCCC1=O |
| InChI | InChI=1S/C5H9NO/c1-6-4-2-3-5(6)7/h2-4H2,1H3 |
| InChIKey | SECXISVLQFMRJM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methylpyrrolidin-2-one (CHEBI:7307) has role polar aprotic solvent (CHEBI:48358) |
| N-methylpyrrolidin-2-one (CHEBI:7307) is a N-alkylpyrrolidine (CHEBI:46775) |
| N-methylpyrrolidin-2-one (CHEBI:7307) is a lactam (CHEBI:24995) |
| N-methylpyrrolidin-2-one (CHEBI:7307) is a pyrrolidin-2-ones (CHEBI:74223) |
| IUPAC Name |
|---|
| 1-methylpyrrolidin-2-one |
| Synonyms | Source |
|---|---|
| 1-Methyl-2-pyrrolidinone | KEGG COMPOUND |
| 1-methylazacyclopentan-2-one | NIST Chemistry WebBook |
| N-methyl-α-pyrrolidinone | NIST Chemistry WebBook |
| N-methyl-α-pyrrolidone | NIST Chemistry WebBook |
| N-methyl-γ-butyrolactam | NIST Chemistry WebBook |
| N-Methyl-2-pyrrolidinone | KEGG COMPOUND |
| Citations |
|---|