EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:73058 - madecassic acid
| Formula | C30H48O6 |
| Net Charge | 0 |
| Average Mass | 504.708 |
| Monoisotopic Mass | 504.34509 |
| SMILES | [H][C@]12CC=C3[C@@](C)(CC[C@@]4(C(=O)O)CC[C@@H](C)[C@H](C)[C@@]34[H])[C@]1(C)C[C@@H](O)[C@]1([H])[C@]2(C)C[C@@H](O)[C@H](O)[C@@]1(C)CO |
| InChI | InChI=1S/C30H48O6/c1-16-9-10-30(25(35)36)12-11-28(5)18(22(30)17(16)2)7-8-21-26(3)13-20(33)24(34)27(4,15-31)23(26)19(32)14-29(21,28)6/h7,16-17,19-24,31-34H,8-15H2,1-6H3,(H,35,36)/t16-,17+,19-,20-,21-,22+,23-,24+,26-,27+,28-,29-,30+/m1/s1 |
| InChIKey | PRAUVHZJPXOEIF-AOLYGAPISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | PubMed (22966846) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| madecassic acid (CHEBI:73058) has parent hydride ursane (CHEBI:35711) |
| madecassic acid (CHEBI:73058) has role antibacterial agent (CHEBI:33282) |
| madecassic acid (CHEBI:73058) has role antineoplastic agent (CHEBI:35610) |
| madecassic acid (CHEBI:73058) has role antioxidant (CHEBI:22586) |
| madecassic acid (CHEBI:73058) has role apoptosis inducer (CHEBI:68495) |
| madecassic acid (CHEBI:73058) has role hypoglycemic agent (CHEBI:35526) |
| madecassic acid (CHEBI:73058) has role plant metabolite (CHEBI:76924) |
| madecassic acid (CHEBI:73058) is a monocarboxylic acid (CHEBI:25384) |
| madecassic acid (CHEBI:73058) is a pentacyclic triterpenoid (CHEBI:25872) |
| madecassic acid (CHEBI:73058) is a tetrol (CHEBI:33573) |
| madecassic acid (CHEBI:73058) is conjugate acid of madecassate (CHEBI:234050) |
| Incoming Relation(s) |
| 2α,3β,6β,23α-tetrahydroxyurs-12-en-28-oic acid 28-O-[β-D-glucosyl-(1→6)-β-D-glucoside] (CHEBI:234054) has functional parent madecassic acid (CHEBI:73058) |
| 2α,3β,6β,23α-tetrahydroxyurs-12-en-28-oic acid 28-O-β-D-glucoside (CHEBI:234053) has functional parent madecassic acid (CHEBI:73058) |
| madecassoside (CHEBI:66651) has functional parent madecassic acid (CHEBI:73058) |
| madecassate (CHEBI:234050) is conjugate base of madecassic acid (CHEBI:73058) |
| IUPAC Name |
|---|
| (2α,3β,6β)-2,3,6,23-tetrahydroxyurs-12-en-28-oic acid |
| Synonyms | Source |
|---|---|
| 6β-hydroxyasiatic acid | ChemIDplus |
| brahmic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| FR2963553 | Patent |
| CN101991578 | Patent |
| TW200938215 | Patent |
| HMDB0036670 | HMDB |
| C00051418 | KNApSAcK |
| LMPR0106180009 | LIPID MAPS |
| DB14037 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3041357 | Reaxys |
| CAS:18449-41-7 | ChemIDplus |
| Citations |
|---|