EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15N4O7 |
| Net Charge | -1 |
| Average Mass | 327.273 |
| Monoisotopic Mass | 327.09462 |
| SMILES | Cc1nc2c(=O)nc(O)[n-]c2n(C[C@H](O)[C@H](O)[C@H](O)CO)c1=O |
| InChI | InChI=1S/C12H16N4O7/c1-4-11(22)16(2-5(18)8(20)6(19)3-17)9-7(13-4)10(21)15-12(23)14-9/h5-6,8,17-20H,2-3H2,1H3,(H2,14,15,21,22,23)/p-1/t5-,6+,8-/m0/s1 |
| InChIKey | BOYBRVGGKOJNFE-BBVRLYRLSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-methyl-7-oxo-8-(1-D-ribityl)lumazine (2-hydroxy tautomer)(1−) (CHEBI:73055) is a organic anion (CHEBI:25696) |
| 6-methyl-7-oxo-8-(1-D-ribityl)lumazine (2-hydroxy tautomer)(1−) (CHEBI:73055) is tautomer of 6-methyl-7-oxo-8-(1-D-ribityl)lumazine (2-oxo tautomer)(1−) (CHEBI:60501) |
| Incoming Relation(s) |
| 6-methyl-7-oxo-8-(1-D-ribityl)lumazine (2-oxo tautomer)(1−) (CHEBI:60501) is tautomer of 6-methyl-7-oxo-8-(1-D-ribityl)lumazine (2-hydroxy tautomer)(1−) (CHEBI:73055) |
| IUPAC Name |
|---|
| 1-deoxy-1-(2-hydroxy-6-methyl-4,7-dioxo-4H-pteridin-1-id-8(7H)-yl)-D-ribitol |