EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19NO6 |
| Net Charge | 0 |
| Average Mass | 261.274 |
| Monoisotopic Mass | 261.12124 |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])OC(=O)CCC(=O)O |
| InChI | InChI=1S/C11H19NO6/c1-12(2,3)7-8(6-10(15)16)18-11(17)5-4-9(13)14/h8H,4-7H2,1-3H3,(H-,13,14,15,16) |
| InChIKey | HAEVNYBCYZZDFL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (20453710) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-succinylcarnitine (CHEBI:73034) has functional parent carnitine (CHEBI:17126) |
| O-succinylcarnitine (CHEBI:73034) has role human metabolite (CHEBI:77746) |
| O-succinylcarnitine (CHEBI:73034) is a O-acylcarnitine (CHEBI:17387) |
| O-succinylcarnitine (CHEBI:73034) is a hemisuccinate (CHEBI:138979) |
| IUPAC Name |
|---|
| 3-[(3-carboxypropanoyl)oxy]-4-(trimethylazaniumyl)butanoate |
| Synonyms | Source |
|---|---|
| 3-[(3-carboxypropanoyl)oxy]-4-(trimethylammonio)butanoate | IUPAC |
| succinylcarnitine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0061717 | HMDB |
| Citations |
|---|