EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34N2O13 |
| Net Charge | 0 |
| Average Mass | 486.471 |
| Monoisotopic Mass | 486.20609 |
| SMILES | N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H34N2O13/c19-4-1-5(20)16(33-18-13(28)11(26)9(24)7(3-22)31-18)14(29)15(4)32-17-12(27)10(25)8(23)6(2-21)30-17/h4-18,21-29H,1-3,19-20H2/t4-,5+,6-,7-,8-,9-,10+,11+,12-,13-,14-,15+,16-,17-,18-/m1/s1 |
| InChIKey | LSQKHXZMWRRDRU-GUKOCFKPSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3''-deamino-3''-hydroxykanamycin X (CHEBI:72992) has functional parent kanamycin X (CHEBI:72797) |
| 3''-deamino-3''-hydroxykanamycin X (CHEBI:72992) is a kanamycins (CHEBI:24951) |
| 3''-deamino-3''-hydroxykanamycin X (CHEBI:72992) is conjugate base of 3''-deamino-3''-hydroxykanamycin X(2+) (CHEBI:72946) |
| Incoming Relation(s) |
| 3''-deamino-3''-hydroxykanamycin X(2+) (CHEBI:72946) is conjugate acid of 3''-deamino-3''-hydroxykanamycin X (CHEBI:72992) |
| IUPAC Name |
|---|
| (1R,2S,3S,4R,6S)-4,6-diamino-3-(α-D-glucopyranosyloxy)-2-hydroxycyclohexyl α-D-glucopyranoside |