EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H36N4O11 |
| Net Charge | 0 |
| Average Mass | 484.503 |
| Monoisotopic Mass | 484.23806 |
| SMILES | NC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](N)C[C@@H]2N)[C@H](N)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H36N4O11/c19-2-6-9(24)11(26)8(22)17(30-6)32-15-4(20)1-5(21)16(14(15)29)33-18-13(28)12(27)10(25)7(3-23)31-18/h4-18,23-29H,1-3,19-22H2/t4-,5+,6+,7+,8+,9+,10+,11+,12-,13+,14-,15+,16-,17+,18+/m0/s1 |
| InChIKey | MOWMHIINUAQFMU-DNBVWFFRSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3''-deamino-3''-hydroxykanamycin B (CHEBI:72990) has functional parent kanamycin B (CHEBI:28098) |
| 3''-deamino-3''-hydroxykanamycin B (CHEBI:72990) is a kanamycins (CHEBI:24951) |
| 3''-deamino-3''-hydroxykanamycin B (CHEBI:72990) is conjugate base of 3''-deamino-3''-hydroxykanamycin B(4+) (CHEBI:72944) |
| Incoming Relation(s) |
| 3''-deamino-3''-hydroxykanamycin B(4+) (CHEBI:72944) is conjugate acid of 3''-deamino-3''-hydroxykanamycin B (CHEBI:72990) |
| IUPAC Name |
|---|
| (1S,2S,3R,4S,6R)-4,6-diamino-3-[(2,6-diamino-2,6-dideoxy-α-D-glucopyranosyl)oxy]-2-hydroxycyclohexyl α-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| nebramycin factor 3 | MetaCyc |
| Nebramycin III | ChemIDplus |
| NK 1012-1 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1694161 | Reaxys |
| CAS:31077-70-0 | ChemIDplus |
| Citations |
|---|