EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28O2 |
| Net Charge | 0 |
| Average Mass | 276.420 |
| Monoisotopic Mass | 276.20893 |
| SMILES | CCCCCCCCCCC1=CC(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C18H28O2/c1-4-5-6-7-8-9-10-11-12-16-13-17(19)14(2)15(3)18(16)20/h13H,4-12H2,1-3H3 |
| InChIKey | APNQQQRDLMWNLM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| decylplastoquinone (CHEBI:72953) has role cofactor (CHEBI:23357) |
| decylplastoquinone (CHEBI:72953) is a 1,4-benzoquinones (CHEBI:132124) |
| IUPAC Name |
|---|
| 5-decyl-2,3-dimethyl-1,4-benzoquinone |
| Synonyms | Source |
|---|---|
| 5-decyl-2,3-dimethylbenzoquinone | ChEBI |
| 5-decyl-2,3-dimethylcyclohexa-2,5-diene-1,4-dione | IUPAC |
| 5-decyl-2,3-dimethyl-p-benzoquinone | ChEBI |
| UniProt Name | Source |
|---|---|
| decylplastoquinone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C02061 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:112055-76-2 | KEGG COMPOUND |
| Citations |
|---|