EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18N2O8 |
| Net Charge | 0 |
| Average Mass | 294.260 |
| Monoisotopic Mass | 294.10632 |
| SMILES | N[C@@H](CC(=O)N[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(=O)O |
| InChI | InChI=1S/C10H18N2O8/c11-3(10(18)19)1-5(14)12-9-8(17)7(16)6(15)4(2-13)20-9/h3-4,6-9,13,15-17H,1-2,11H2,(H,12,14)(H,18,19)/t3-,4+,6+,7-,8+,9+/m0/s1 |
| InChIKey | RDVZONQWDDILKB-ITZFQDDFSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Glycosyl-L-asparagine (CHEBI:7292) is a glyco-amino acid (CHEBI:35258) |
| Synonyms | Source |
|---|---|
| N-L-β-aspartyl-β-D-glucopyranosylamine | ChEBI |
| N-Glycosyl-L-asparagine | KEGG COMPOUND |