EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | CCCCCC(O)/C=C/C=C\C/C=C\C=C\C(O)CCCC(=O)O |
| InChI | InChI=1S/C20H32O4/c1-2-3-9-13-18(21)14-10-7-5-4-6-8-11-15-19(22)16-12-17-20(23)24/h5-8,10-11,14-15,18-19,21-22H,2-4,9,12-13,16-17H2,1H3,(H,23,24)/b7-5-,8-6-,14-10+,15-11+ |
| InChIKey | UXGXCGPWGSUMNI-PCTZFDORSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,15-DiHETE (CHEBI:72867) has functional parent 5-HETE (CHEBI:60943) |
| 5,15-DiHETE (CHEBI:72867) has role metabolite (CHEBI:25212) |
| 5,15-DiHETE (CHEBI:72867) is a dihydroxyicosatetraenoic acid (CHEBI:72868) |
| IUPAC Name |
|---|
| (6E,8Z,11Z,13E)-5,15-dihydroxyicosa-6,8,11,13-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 5,15-dihydroxy-6E,8Z,11Z,13E-eicosatetraenoic acid | ChEBI |
| 5,15-dihydroxy-6E,8Z,11Z,13E-icosatetraenoic acid | ChEBI |
| (6E,8Z,11Z,13E)-5,15-dihydroxyeicosa-6,8,11,13-tetraenoic acid | ChEBI |